C13H14ClF3O4 — CID 103210181
1-(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-3-(2,2,2-trifluoroethoxy)propan-1-ol (PubChem CID 103210181) has the molecular formula C13H14ClF3O4 and a molecular weight of 326.70 g/mol. Its IUPAC name is 1-(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-3-(2,2,2-trifluoroethoxy)propan-1-ol.
| Compound Name | 1-(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-3-(2,2,2-trifluoroethoxy)propan-1-ol |
|---|---|
| PubChem CID | 103210181 |
| Molecular Formula | C13H14ClF3O4 |
| Molecular Weight | 326.70 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 1-(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-3-(2,2,2-trifluoroethoxy)propan-1-ol |
| SMILES | OC(CCOCC(F)(F)F)c1cc2c(cc1Cl)OCCO2 |
| InChI | InChI=1S/C13H14ClF3O4/c14-9-6-12-11(20-3-4-21-12)5-8(9)10(18)1-2-19-7-13(15,16)17/h5-6,10,18H,1-4,7H2 |
| InChIKey | HWQXDPAUWNLGAH-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.70 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|