C10H11ClO3 — CID 82759401
(1S)-1-(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)ethanol (PubChem CID 82759401) has the molecular formula C10H11ClO3 and a molecular weight of 214.65 g/mol. Its IUPAC name is (1S)-1-(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)ethanol.
| Compound Name | (1S)-1-(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)ethanol |
|---|---|
| PubChem CID | 82759401 |
| Molecular Formula | C10H11ClO3 |
| Molecular Weight | 214.65 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | (1S)-1-(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)ethanol |
| SMILES | C[C@H](O)c1cc2c(cc1Cl)OCCO2 |
| InChI | InChI=1S/C10H11ClO3/c1-6(12)7-4-9-10(5-8(7)11)14-3-2-13-9/h4-6,12H,2-3H2,1H3/t6-/m0/s1 |
| InChIKey | GYTUUBCIPOCQDC-LURJTMIESA-N |
| XLogP | 2.16 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.65 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |