C15H22ClNO3 — CID 83922311
5-amino-2-(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)heptan-4-ol (PubChem CID 83922311) has the molecular formula C15H22ClNO3 and a molecular weight of 299.80 g/mol. Its IUPAC name is 5-amino-2-(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)heptan-4-ol.
| Compound Name | 5-amino-2-(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)heptan-4-ol |
|---|---|
| PubChem CID | 83922311 |
| Molecular Formula | C15H22ClNO3 |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 5-amino-2-(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)heptan-4-ol |
| SMILES | CCC(N)C(O)CC(C)c1cc2c(cc1Cl)OCCO2 |
| InChI | InChI=1S/C15H22ClNO3/c1-3-12(17)13(18)6-9(2)10-7-14-15(8-11(10)16)20-5-4-19-14/h7-9,12-13,18H,3-6,17H2,1-2H3 |
| InChIKey | FGGNBEIEPDEBHJ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |