C15H19ClO2 — CID 83922297
6-chloro-7-[(Z)-hept-4-en-2-yl]-2,3-dihydro-1,4-benzodioxine (PubChem CID 83922297) has the molecular formula C15H19ClO2 and a molecular weight of 266.77 g/mol. Its IUPAC name is 6-chloro-7-[(Z)-hept-4-en-2-yl]-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 6-chloro-7-[(Z)-hept-4-en-2-yl]-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 83922297 |
| Molecular Formula | C15H19ClO2 |
| Molecular Weight | 266.77 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 6-chloro-7-[(Z)-hept-4-en-2-yl]-2,3-dihydro-1,4-benzodioxine |
| SMILES | CC/C=C\CC(C)c1cc2c(cc1Cl)OCCO2 |
| InChI | InChI=1S/C15H19ClO2/c1-3-4-5-6-11(2)12-9-14-15(10-13(12)16)18-8-7-17-14/h4-5,9-11H,3,6-8H2,1-2H3/b5-4- |
| InChIKey | MIZINFAKOIRGSD-PLNGDYQASA-N |
| XLogP | 4.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.77 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|