C11H11Cl2F3O2 — CID 103147543
1-(2,3-dichlorophenyl)-3-(2,2,2-trifluoroethoxy)propan-1-ol (PubChem CID 103147543) has the molecular formula C11H11Cl2F3O2 and a molecular weight of 303.11 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-3-(2,2,2-trifluoroethoxy)propan-1-ol.
| Compound Name | 1-(2,3-dichlorophenyl)-3-(2,2,2-trifluoroethoxy)propan-1-ol |
|---|---|
| PubChem CID | 103147543 |
| Molecular Formula | C11H11Cl2F3O2 |
| Molecular Weight | 303.11 g/mol |
| Exact Mass | 302.01 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-3-(2,2,2-trifluoroethoxy)propan-1-ol |
| SMILES | OC(CCOCC(F)(F)F)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C11H11Cl2F3O2/c12-8-3-1-2-7(10(8)13)9(17)4-5-18-6-11(14,15)16/h1-3,9,17H,4-6H2 |
| InChIKey | CSAYRWFRHBLTGH-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.11 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|