C14H14F3NO2 — CID 103147546
1-isoquinolin-4-yl-3-(2,2,2-trifluoroethoxy)propan-1-ol (PubChem CID 103147546) has the molecular formula C14H14F3NO2 and a molecular weight of 285.27 g/mol. Its IUPAC name is 1-isoquinolin-4-yl-3-(2,2,2-trifluoroethoxy)propan-1-ol.
| Compound Name | 1-isoquinolin-4-yl-3-(2,2,2-trifluoroethoxy)propan-1-ol |
|---|---|
| PubChem CID | 103147546 |
| Molecular Formula | C14H14F3NO2 |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 1-isoquinolin-4-yl-3-(2,2,2-trifluoroethoxy)propan-1-ol |
| SMILES | OC(CCOCC(F)(F)F)c1cncc2ccccc12 |
| InChI | InChI=1S/C14H14F3NO2/c15-14(16,17)9-20-6-5-13(19)12-8-18-7-10-3-1-2-4-11(10)12/h1-4,7-8,13,19H,5-6,9H2 |
| InChIKey | GNNMMPQUBQDVOY-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|