C13H14F3N3 — CID 105248975
(4,4,4-trifluoro-1-isoquinolin-4-ylbutyl)hydrazine (PubChem CID 105248975) has the molecular formula C13H14F3N3 and a molecular weight of 269.27 g/mol. Its IUPAC name is (4,4,4-trifluoro-1-isoquinolin-4-ylbutyl)hydrazine.
| Compound Name | (4,4,4-trifluoro-1-isoquinolin-4-ylbutyl)hydrazine |
|---|---|
| PubChem CID | 105248975 |
| Molecular Formula | C13H14F3N3 |
| Molecular Weight | 269.27 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | (4,4,4-trifluoro-1-isoquinolin-4-ylbutyl)hydrazine |
| SMILES | NNC(CCC(F)(F)F)c1cncc2ccccc12 |
| InChI | InChI=1S/C13H14F3N3/c14-13(15,16)6-5-12(19-17)11-8-18-7-9-3-1-2-4-10(9)11/h1-4,7-8,12,19H,5-6,17H2 |
| InChIKey | FLNVLFLWJUCOHS-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.27 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|