C14H16F2N2O — CID 103149098
3-(2,2-difluoroethoxy)-1-isoquinolin-4-ylpropan-1-amine (PubChem CID 103149098) has the molecular formula C14H16F2N2O and a molecular weight of 266.29 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-1-isoquinolin-4-ylpropan-1-amine.
| Compound Name | 3-(2,2-difluoroethoxy)-1-isoquinolin-4-ylpropan-1-amine |
|---|---|
| PubChem CID | 103149098 |
| Molecular Formula | C14H16F2N2O |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-1-isoquinolin-4-ylpropan-1-amine |
| SMILES | NC(CCOCC(F)F)c1cncc2ccccc12 |
| InChI | InChI=1S/C14H16F2N2O/c15-14(16)9-19-6-5-13(17)12-8-18-7-10-3-1-2-4-11(10)12/h1-4,7-8,13-14H,5-6,9,17H2 |
| InChIKey | JJIXWTZXGCRRBT-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|