C12H18ClNO3 — CID 54563493
4-[2-(tert-butylamino)-1-hydroxyethyl]-3-chlorobenzene-1,2-diol (PubChem CID 54563493) has the molecular formula C12H18ClNO3 and a molecular weight of 259.73 g/mol. Its IUPAC name is 4-[2-(tert-butylamino)-1-hydroxyethyl]-3-chlorobenzene-1,2-diol.
| Compound Name | 4-[2-(tert-butylamino)-1-hydroxyethyl]-3-chlorobenzene-1,2-diol |
|---|---|
| PubChem CID | 54563493 |
| Molecular Formula | C12H18ClNO3 |
| Molecular Weight | 259.73 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 4-[2-(tert-butylamino)-1-hydroxyethyl]-3-chlorobenzene-1,2-diol |
| SMILES | CC(C)(C)NCC(O)c1ccc(O)c(O)c1Cl |
| InChI | InChI=1S/C12H18ClNO3/c1-12(2,3)14-6-9(16)7-4-5-8(15)11(17)10(7)13/h4-5,9,14-17H,6H2,1-3H3 |
| InChIKey | ZSFGFZVHWJGAFS-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.73 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|