C14H22FNO4 — CID 138473211
acetic acid;2-[2-(tert-butylamino)-1-hydroxyethyl]-5-fluorophenol (PubChem CID 138473211) has the molecular formula C14H22FNO4 and a molecular weight of 287.33 g/mol. Its IUPAC name is acetic acid;2-[2-(tert-butylamino)-1-hydroxyethyl]-5-fluorophenol.
| Compound Name | acetic acid;2-[2-(tert-butylamino)-1-hydroxyethyl]-5-fluorophenol |
|---|---|
| PubChem CID | 138473211 |
| Molecular Formula | C14H22FNO4 |
| Molecular Weight | 287.33 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | acetic acid;2-[2-(tert-butylamino)-1-hydroxyethyl]-5-fluorophenol |
| SMILES | CC(=O)O.CC(C)(C)NCC(O)c1ccc(F)cc1O |
| InChI | InChI=1S/C12H18FNO2.C2H4O2/c1-12(2,3)14-7-11(16)9-5-4-8(13)6-10(9)15;1-2(3)4/h4-6,11,14-16H,7H2,1-3H3;1H3,(H,3,4) |
| InChIKey | CAQZOAHKIUNUOY-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.33 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |