C15H20N2O5 — CID 70481790
[4-[2-(tert-butylamino)-1-hydroxyethyl]-7-hydroxy-1H-indol-2-yl] hydrogen carbonate (PubChem CID 70481790) has the molecular formula C15H20N2O5 and a molecular weight of 308.33 g/mol. Its IUPAC name is [4-[2-(tert-butylamino)-1-hydroxyethyl]-7-hydroxy-1H-indol-2-yl] hydrogen carbonate.
| Compound Name | [4-[2-(tert-butylamino)-1-hydroxyethyl]-7-hydroxy-1H-indol-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 70481790 |
| Molecular Formula | C15H20N2O5 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | [4-[2-(tert-butylamino)-1-hydroxyethyl]-7-hydroxy-1H-indol-2-yl] hydrogen carbonate |
| SMILES | CC(C)(C)NCC(O)c1ccc(O)c2[nH]c(OC(=O)O)cc12 |
| InChI | InChI=1S/C15H20N2O5/c1-15(2,3)16-7-11(19)8-4-5-10(18)13-9(8)6-12(17-13)22-14(20)21/h4-6,11,16-19H,7H2,1-3H3,(H,20,21) |
| InChIKey | GEHOWGXYSRMIIE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 114.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |