C21H30N2O6 — CID 13243470
2,2-dimethylpropanoyloxymethyl 4-[2-(tert-butylamino)-1-hydroxyethyl]-7-hydroxy-1H-indole-2-carboxylate (PubChem CID 13243470) has the molecular formula C21H30N2O6 and a molecular weight of 406.48 g/mol. Its IUPAC name is 2,2-dimethylpropanoyloxymethyl 4-[2-(tert-butylamino)-1-hydroxyethyl]-7-hydroxy-1H-indole-2-carboxylate.
| Compound Name | 2,2-dimethylpropanoyloxymethyl 4-[2-(tert-butylamino)-1-hydroxyethyl]-7-hydroxy-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 13243470 |
| Molecular Formula | C21H30N2O6 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | 2,2-dimethylpropanoyloxymethyl 4-[2-(tert-butylamino)-1-hydroxyethyl]-7-hydroxy-1H-indole-2-carboxylate |
| SMILES | CC(C)(C)NCC(O)c1ccc(O)c2[nH]c(C(=O)OCOC(=O)C(C)(C)C)cc12 |
| InChI | InChI=1S/C21H30N2O6/c1-20(2,3)19(27)29-11-28-18(26)14-9-13-12(7-8-15(24)17(13)23-14)16(25)10-22-21(4,5)6/h7-9,16,22-25H,10-11H2,1-6H3 |
| InChIKey | YWZRVEHFRBJSNL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 120.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|