C19H26N2O5 — CID 70482880
[4-[2-(cyclohexylamino)-1-hydroxyethyl]-7-hydroxy-1H-indol-2-yl] ethyl carbonate (PubChem CID 70482880) has the molecular formula C19H26N2O5 and a molecular weight of 362.43 g/mol. Its IUPAC name is [4-[2-(cyclohexylamino)-1-hydroxyethyl]-7-hydroxy-1H-indol-2-yl] ethyl carbonate.
| Compound Name | [4-[2-(cyclohexylamino)-1-hydroxyethyl]-7-hydroxy-1H-indol-2-yl] ethyl carbonate |
|---|---|
| PubChem CID | 70482880 |
| Molecular Formula | C19H26N2O5 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | [4-[2-(cyclohexylamino)-1-hydroxyethyl]-7-hydroxy-1H-indol-2-yl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1cc2c(C(O)CNC3CCCCC3)ccc(O)c2[nH]1 |
| InChI | InChI=1S/C19H26N2O5/c1-2-25-19(24)26-17-10-14-13(8-9-15(22)18(14)21-17)16(23)11-20-12-6-4-3-5-7-12/h8-10,12,16,20-23H,2-7,11H2,1H3 |
| InChIKey | ANQXKZQGVPLVQU-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 103.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |