C12H15ClN2O5 — CID 70482628
[4-(2-amino-1-hydroxyethyl)-7-hydroxy-1H-indol-2-yl] methyl carbonate;hydrochloride (PubChem CID 70482628) has the molecular formula C12H15ClN2O5 and a molecular weight of 302.71 g/mol. Its IUPAC name is [4-(2-amino-1-hydroxyethyl)-7-hydroxy-1H-indol-2-yl] methyl carbonate;hydrochloride.
| Compound Name | [4-(2-amino-1-hydroxyethyl)-7-hydroxy-1H-indol-2-yl] methyl carbonate;hydrochloride |
|---|---|
| PubChem CID | 70482628 |
| Molecular Formula | C12H15ClN2O5 |
| Molecular Weight | 302.71 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | [4-(2-amino-1-hydroxyethyl)-7-hydroxy-1H-indol-2-yl] methyl carbonate;hydrochloride |
| SMILES | COC(=O)Oc1cc2c(C(O)CN)ccc(O)c2[nH]1.Cl |
| InChI | InChI=1S/C12H14N2O5.ClH/c1-18-12(17)19-10-4-7-6(9(16)5-13)2-3-8(15)11(7)14-10;/h2-4,9,14-16H,5,13H2,1H3;1H |
| InChIKey | HEGADZJKOVWZIC-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 117.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.71 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |