C26H44N2O8S — CID 127256212
bis(4-[2-(tert-butylamino)-1-hydroxyethyl]-2-methylphenol);sulfuric acid (PubChem CID 127256212) has the molecular formula C26H44N2O8S and a molecular weight of 544.71 g/mol. Its IUPAC name is bis(4-[2-(tert-butylamino)-1-hydroxyethyl]-2-methylphenol);sulfuric acid.
| Compound Name | bis(4-[2-(tert-butylamino)-1-hydroxyethyl]-2-methylphenol);sulfuric acid |
|---|---|
| PubChem CID | 127256212 |
| Molecular Formula | C26H44N2O8S |
| Molecular Weight | 544.71 g/mol |
| Exact Mass | 544.28 |
| IUPAC Name | bis(4-[2-(tert-butylamino)-1-hydroxyethyl]-2-methylphenol);sulfuric acid |
| SMILES | Cc1cc(C(O)CNC(C)(C)C)ccc1O.Cc1cc(C(O)CNC(C)(C)C)ccc1O.O=S(=O)(O)O |
| InChI | InChI=1S/2C13H21NO2.H2O4S/c2*1-9-7-10(5-6-11(9)15)12(16)8-14-13(2,3)4;1-5(2,3)4/h2*5-7,12,14-16H,8H2,1-4H3;(H2,1,2,3,4) |
| InChIKey | JJAOBLMGZKBLSL-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 179.58 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.71 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|