C13H19B2NO3 — CID 153349668
CID 153349668 (PubChem CID 153349668) has the molecular formula C13H19B2NO3 and a molecular weight of 258.92 g/mol.
| Compound Name | CID 153349668 |
|---|---|
| PubChem CID | 153349668 |
| Molecular Formula | C13H19B2NO3 |
| Molecular Weight | 258.92 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | — |
| SMILES | [B]C([B])(O)c1cc([C@H](O)CNC(C)(C)C)ccc1O |
| InChI | InChI=1S/C13H19B2NO3/c1-12(2,3)16-7-11(18)8-4-5-10(17)9(6-8)13(14,15)19/h4-6,11,16-19H,7H2,1-3H3/t11-/m1/s1 |
| InChIKey | RIFPGDZUMKSVLZ-LLVKDONJSA-N |
| XLogP | 0.25 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.92 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|