C12H19NO3 — CID 71314580
4-[2-[[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]amino]-1-hydroxyethyl]benzene-1,2-diol (PubChem CID 71314580) has the molecular formula C12H19NO3 and a molecular weight of 234.34 g/mol. Its IUPAC name is 4-[2-[[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]amino]-1-hydroxyethyl]benzene-1,2-diol.
| Compound Name | 4-[2-[[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]amino]-1-hydroxyethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 71314580 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.19 |
| IUPAC Name | 4-[2-[[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]amino]-1-hydroxyethyl]benzene-1,2-diol |
| SMILES | [2H]C([2H])([2H])C(NCC(O)c1ccc(O)c(O)c1)(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C12H19NO3/c1-12(2,3)13-7-11(16)8-4-5-9(14)10(15)6-8/h4-6,11,13-16H,7H2,1-3H3/i1D3,2D3,3D3 |
| InChIKey | PHSMOUBHYUFTDM-GQALSZNTSA-N |
| XLogP | 1.52 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|