C13H21NO4 — CID 559424
4-[3-(tert-butylamino)-1,2-dihydroxypropyl]benzene-1,2-diol (PubChem CID 559424) has the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. Its IUPAC name is 4-[3-(tert-butylamino)-1,2-dihydroxypropyl]benzene-1,2-diol.
| Compound Name | 4-[3-(tert-butylamino)-1,2-dihydroxypropyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 559424 |
| Molecular Formula | C13H21NO4 |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 4-[3-(tert-butylamino)-1,2-dihydroxypropyl]benzene-1,2-diol |
| SMILES | CC(C)(C)NCC(O)C(O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C13H21NO4/c1-13(2,3)14-7-11(17)12(18)8-4-5-9(15)10(16)6-8/h4-6,11-12,14-18H,7H2,1-3H3 |
| InChIKey | OZOMHJHXRAOJDR-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|