C9H14NO3+ — CID 6919631
[(1S,2S)-1-(3,4-dihydroxyphenyl)-1-hydroxypropan-2-yl]azanium (PubChem CID 6919631) has the molecular formula C9H14NO3+ and a molecular weight of 184.22 g/mol. Its IUPAC name is [(1S,2S)-1-(3,4-dihydroxyphenyl)-1-hydroxypropan-2-yl]azanium.
| Compound Name | [(1S,2S)-1-(3,4-dihydroxyphenyl)-1-hydroxypropan-2-yl]azanium |
|---|---|
| PubChem CID | 6919631 |
| Molecular Formula | C9H14NO3+ |
| Molecular Weight | 184.22 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | [(1S,2S)-1-(3,4-dihydroxyphenyl)-1-hydroxypropan-2-yl]azanium |
| SMILES | C[C@H]([NH3+])[C@@H](O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C9H13NO3/c1-5(10)9(13)6-2-3-7(11)8(12)4-6/h2-5,9,11-13H,10H2,1H3/p+1/t5-,9+/m0/s1 |
| InChIKey | GEFQWZLICWMTKF-SSDLBLMSSA-O |
| XLogP | -0.24 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.22 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|