C13H19NO4 — CID 11971899
4-(1-hydroxy-2-morpholin-4-ylpropyl)benzene-1,2-diol (PubChem CID 11971899) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is 4-(1-hydroxy-2-morpholin-4-ylpropyl)benzene-1,2-diol.
| Compound Name | 4-(1-hydroxy-2-morpholin-4-ylpropyl)benzene-1,2-diol |
|---|---|
| PubChem CID | 11971899 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 4-(1-hydroxy-2-morpholin-4-ylpropyl)benzene-1,2-diol |
| SMILES | CC(C(O)c1ccc(O)c(O)c1)N1CCOCC1 |
| InChI | InChI=1S/C13H19NO4/c1-9(14-4-6-18-7-5-14)13(17)10-2-3-11(15)12(16)8-10/h2-3,8-9,13,15-17H,4-7H2,1H3 |
| InChIKey | RUVMXBYZZIZZEK-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|