C20H23F2NO3 — CID 73195170
1-[1-(3-fluoro-4-hydroxyphenyl)-1-hydroxypropan-2-yl]-4-(4-fluorophenyl)piperidin-4-ol (PubChem CID 73195170) has the molecular formula C20H23F2NO3 and a molecular weight of 363.40 g/mol. Its IUPAC name is 1-[1-(3-fluoro-4-hydroxyphenyl)-1-hydroxypropan-2-yl]-4-(4-fluorophenyl)piperidin-4-ol.
| Compound Name | 1-[1-(3-fluoro-4-hydroxyphenyl)-1-hydroxypropan-2-yl]-4-(4-fluorophenyl)piperidin-4-ol |
|---|---|
| PubChem CID | 73195170 |
| Molecular Formula | C20H23F2NO3 |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 1-[1-(3-fluoro-4-hydroxyphenyl)-1-hydroxypropan-2-yl]-4-(4-fluorophenyl)piperidin-4-ol |
| SMILES | CC(C(O)c1ccc(O)c(F)c1)N1CCC(O)(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H23F2NO3/c1-13(19(25)14-2-7-18(24)17(22)12-14)23-10-8-20(26,9-11-23)15-3-5-16(21)6-4-15/h2-7,12-13,19,24-26H,8-11H2,1H3 |
| InChIKey | RSSJKZMFJIBSIP-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |