About 1-[1-(3,5-difluoro-4-hydroxyphenyl)-1-hydroxypropan-2-yl]-4-phenylpiperidin-4-ol
1-[1-(3,5-difluoro-4-hydroxyphenyl)-1-hydroxypropan-2-yl]-4-phenylpiperidin-4-ol (PubChem CID 21186599) has the molecular formula C20H23F2NO3
and a molecular weight of 363.40 g/mol. Its IUPAC name is 1-[1-(3,5-difluoro-4-hydroxyphenyl)-1-hydroxypropan-2-yl]-4-phenylpiperidin-4-ol.
Molecular Properties
| Compound Name | 1-[1-(3,5-difluoro-4-hydroxyphenyl)-1-hydroxypropan-2-yl]-4-phenylpiperidin-4-ol |
| PubChem CID | 21186599 |
| Molecular Formula | C20H23F2NO3 |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 1-[1-(3,5-difluoro-4-hydroxyphenyl)-1-hydroxypropan-2-yl]-4-phenylpiperidin-4-ol |
| SMILES | CC(C(O)c1cc(F)c(O)c(F)c1)N1CCC(O)(c2ccccc2)CC1 |
| InChI | InChI=1S/C20H23F2NO3/c1-13(18(24)14-11-16(21)19(25)17(22)12-14)23-9-7-20(26,8-10-23)15-5-3-2-4-6-15/h2-6,11-13,18,24-26H,7-10H2,1H3 |
| InChIKey | QTNJOWUDVKMQOD-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[1-(3,5-difluoro-4-hydroxyphenyl)-1-hydroxypropan-2-yl]-4-phenylpiperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(3,5-difluoro-4-hydroxyphenyl)-1-hydroxypropan-2-yl]-4-phenylpiperidin-4-ol?
The IUPAC name of 1-[1-(3,5-difluoro-4-hydroxyphenyl)-1-hydroxypropan-2-yl]-4-phenylpiperidin-4-ol (CID 21186599) is 1-[1-(3,5-difluoro-4-hydroxyphenyl)-1-hydroxypropan-2-yl]-4-phenylpiperidin-4-ol.
What is the SMILES notation for 1-[1-(3,5-difluoro-4-hydroxyphenyl)-1-hydroxypropan-2-yl]-4-phenylpiperidin-4-ol?
The canonical SMILES for 1-[1-(3,5-difluoro-4-hydroxyphenyl)-1-hydroxypropan-2-yl]-4-phenylpiperidin-4-ol is CC(C(O)c1cc(F)c(O)c(F)c1)N1CCC(O)(c2ccccc2)CC1.
What is the InChIKey of 1-[1-(3,5-difluoro-4-hydroxyphenyl)-1-hydroxypropan-2-yl]-4-phenylpiperidin-4-ol?
The InChIKey is QTNJOWUDVKMQOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23F2NO3/c1-13(18(24)14-11-16(21)19(25)17(22)12-14)23-9-7-20(26,8-10-23)15-5-3-2-4-6-15/h2-6,11-13,18,24-26H,7-10H2,1H3.
What are the key properties of 1-[1-(3,5-difluoro-4-hydroxyphenyl)-1-hydroxypropan-2-yl]-4-phenylpiperidin-4-ol?
1-[1-(3,5-difluoro-4-hydroxyphenyl)-1-hydroxypropan-2-yl]-4-phenylpiperidin-4-ol has a molecular weight of 363.40 g/mol, XLogP of 3.08, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(3,5-difluoro-4-hydroxyphenyl)-1-hydroxypropan-2-yl]-4-phenylpiperidin-4-ol is sourced from PubChem (CID 21186599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).