C22H29FN2O — CID 72949869
1-[3-(dimethylamino)-1-(4-fluorophenyl)propyl]-4-phenylpiperidin-4-ol (PubChem CID 72949869) has the molecular formula C22H29FN2O and a molecular weight of 356.49 g/mol. Its IUPAC name is 1-[3-(dimethylamino)-1-(4-fluorophenyl)propyl]-4-phenylpiperidin-4-ol.
| Compound Name | 1-[3-(dimethylamino)-1-(4-fluorophenyl)propyl]-4-phenylpiperidin-4-ol |
|---|---|
| PubChem CID | 72949869 |
| Molecular Formula | C22H29FN2O |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | 1-[3-(dimethylamino)-1-(4-fluorophenyl)propyl]-4-phenylpiperidin-4-ol |
| SMILES | CN(C)CCC(c1ccc(F)cc1)N1CCC(O)(c2ccccc2)CC1 |
| InChI | InChI=1S/C22H29FN2O/c1-24(2)15-12-21(18-8-10-20(23)11-9-18)25-16-13-22(26,14-17-25)19-6-4-3-5-7-19/h3-11,21,26H,12-17H2,1-2H3 |
| InChIKey | QEGDWFPHRMABMG-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |