C28H30ClNO2 — CID 23365028
4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-1-(4-methylphenyl)-4-phenylbutan-1-one (PubChem CID 23365028) has the molecular formula C28H30ClNO2 and a molecular weight of 448.01 g/mol. Its IUPAC name is 4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-1-(4-methylphenyl)-4-phenylbutan-1-one.
| Compound Name | 4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-1-(4-methylphenyl)-4-phenylbutan-1-one |
|---|---|
| PubChem CID | 23365028 |
| Molecular Formula | C28H30ClNO2 |
| Molecular Weight | 448.01 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | 4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-1-(4-methylphenyl)-4-phenylbutan-1-one |
| SMILES | Cc1ccc(C(=O)CCC(c2ccccc2)N2CCC(O)(c3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C28H30ClNO2/c1-21-7-9-23(10-8-21)27(31)16-15-26(22-5-3-2-4-6-22)30-19-17-28(32,18-20-30)24-11-13-25(29)14-12-24/h2-14,26,32H,15-20H2,1H3 |
| InChIKey | GFVJVNGRTDAKEN-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.01 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |