C28H32ClNO — CID 11648468
4-(4-chlorophenyl)-1-[4-(4-methylphenyl)-4-phenylbutyl]piperidin-4-ol (PubChem CID 11648468) has the molecular formula C28H32ClNO and a molecular weight of 434.02 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-1-[4-(4-methylphenyl)-4-phenylbutyl]piperidin-4-ol.
| Compound Name | 4-(4-chlorophenyl)-1-[4-(4-methylphenyl)-4-phenylbutyl]piperidin-4-ol |
|---|---|
| PubChem CID | 11648468 |
| Molecular Formula | C28H32ClNO |
| Molecular Weight | 434.02 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | 4-(4-chlorophenyl)-1-[4-(4-methylphenyl)-4-phenylbutyl]piperidin-4-ol |
| SMILES | Cc1ccc(C(CCCN2CCC(O)(c3ccc(Cl)cc3)CC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H32ClNO/c1-22-9-11-24(12-10-22)27(23-6-3-2-4-7-23)8-5-19-30-20-17-28(31,18-21-30)25-13-15-26(29)16-14-25/h2-4,6-7,9-16,27,31H,5,8,17-21H2,1H3 |
| InChIKey | XQNMWCOBHLDKFW-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.02 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |