C30H33F2NO2 — CID 53320075
[1-[4,4-bis(4-fluorophenyl)butyl]-4-(4-methylphenyl)piperidin-4-yl] acetate (PubChem CID 53320075) has the molecular formula C30H33F2NO2 and a molecular weight of 477.60 g/mol. Its IUPAC name is [1-[4,4-bis(4-fluorophenyl)butyl]-4-(4-methylphenyl)piperidin-4-yl] acetate.
| Compound Name | [1-[4,4-bis(4-fluorophenyl)butyl]-4-(4-methylphenyl)piperidin-4-yl] acetate |
|---|---|
| PubChem CID | 53320075 |
| Molecular Formula | C30H33F2NO2 |
| Molecular Weight | 477.60 g/mol |
| Exact Mass | 477.25 |
| IUPAC Name | [1-[4,4-bis(4-fluorophenyl)butyl]-4-(4-methylphenyl)piperidin-4-yl] acetate |
| SMILES | CC(=O)OC1(c2ccc(C)cc2)CCN(CCCC(c2ccc(F)cc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C30H33F2NO2/c1-22-5-11-26(12-6-22)30(35-23(2)34)17-20-33(21-18-30)19-3-4-29(24-7-13-27(31)14-8-24)25-9-15-28(32)16-10-25/h5-16,29H,3-4,17-21H2,1-2H3 |
| InChIKey | IKXRIKJMBBLKMW-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.60 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |