C46H48Cl2F2N2O6 — CID 118709159
bis[4-(4-chlorophenyl)-1-[4-(4-fluorophenyl)-4-oxobutyl]piperidin-4-yl] butanedioate (PubChem CID 118709159) has the molecular formula C46H48Cl2F2N2O6 and a molecular weight of 833.80 g/mol. Its IUPAC name is bis[4-(4-chlorophenyl)-1-[4-(4-fluorophenyl)-4-oxobutyl]piperidin-4-yl] butanedioate.
| Compound Name | bis[4-(4-chlorophenyl)-1-[4-(4-fluorophenyl)-4-oxobutyl]piperidin-4-yl] butanedioate |
|---|---|
| PubChem CID | 118709159 |
| Molecular Formula | C46H48Cl2F2N2O6 |
| Molecular Weight | 833.80 g/mol |
| Exact Mass | 832.29 |
| IUPAC Name | bis[4-(4-chlorophenyl)-1-[4-(4-fluorophenyl)-4-oxobutyl]piperidin-4-yl] butanedioate |
| SMILES | O=C(CCC(=O)OC1(c2ccc(Cl)cc2)CCN(CCCC(=O)c2ccc(F)cc2)CC1)OC1(c2ccc(Cl)cc2)CCN(CCCC(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C46H48Cl2F2N2O6/c47-37-13-9-35(10-14-37)45(23-29-51(30-24-45)27-1-3-41(53)33-5-17-39(49)18-6-33)57-43(55)21-22-44(56)58-46(36-11-15-38(48)16-12-36)25-31-52(32-26-46)28-2-4-42(54)34-7-19-40(50)20-8-34/h5-20H,1-4,21-32H2 |
| InChIKey | FCLHHKLNBKMBPS-UHFFFAOYSA-N |
| XLogP | 9.75 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.80 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |