C24H31ClFNO2Si — CID 626648
4-[4-(4-chlorophenyl)-4-trimethylsilyloxypiperidin-1-yl]-1-(4-fluorophenyl)butan-1-one (PubChem CID 626648) has the molecular formula C24H31ClFNO2Si and a molecular weight of 448.05 g/mol. Its IUPAC name is 4-[4-(4-chlorophenyl)-4-trimethylsilyloxypiperidin-1-yl]-1-(4-fluorophenyl)butan-1-one.
| Compound Name | 4-[4-(4-chlorophenyl)-4-trimethylsilyloxypiperidin-1-yl]-1-(4-fluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 626648 |
| Molecular Formula | C24H31ClFNO2Si |
| Molecular Weight | 448.05 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | 4-[4-(4-chlorophenyl)-4-trimethylsilyloxypiperidin-1-yl]-1-(4-fluorophenyl)butan-1-one |
| SMILES | C[Si](C)(C)OC1(c2ccc(Cl)cc2)CCN(CCCC(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C24H31ClFNO2Si/c1-30(2,3)29-24(20-8-10-21(25)11-9-20)14-17-27(18-15-24)16-4-5-23(28)19-6-12-22(26)13-7-19/h6-13H,4-5,14-18H2,1-3H3 |
| InChIKey | GANQAEPVTSXCFF-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.05 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|