C22H25ClFNO2 — CID 11200115
4-[3-(4-chlorophenyl)-3-(2-hydroxyethyl)pyrrolidin-1-yl]-1-(4-fluorophenyl)butan-1-one (PubChem CID 11200115) has the molecular formula C22H25ClFNO2 and a molecular weight of 389.90 g/mol. Its IUPAC name is 4-[3-(4-chlorophenyl)-3-(2-hydroxyethyl)pyrrolidin-1-yl]-1-(4-fluorophenyl)butan-1-one.
| Compound Name | 4-[3-(4-chlorophenyl)-3-(2-hydroxyethyl)pyrrolidin-1-yl]-1-(4-fluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 11200115 |
| Molecular Formula | C22H25ClFNO2 |
| Molecular Weight | 389.90 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 4-[3-(4-chlorophenyl)-3-(2-hydroxyethyl)pyrrolidin-1-yl]-1-(4-fluorophenyl)butan-1-one |
| SMILES | O=C(CCCN1CCC(CCO)(c2ccc(Cl)cc2)C1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H25ClFNO2/c23-19-7-5-18(6-8-19)22(12-15-26)11-14-25(16-22)13-1-2-21(27)17-3-9-20(24)10-4-17/h3-10,26H,1-2,11-16H2 |
| InChIKey | YEHRQVUHEWQQQF-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.90 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |