C49H54Cl2F2N2O6 — CID 118709162
bis[4-(4-chlorophenyl)-1-[4-(4-fluorophenyl)-4-oxobutyl]piperidin-4-yl] heptanedioate (PubChem CID 118709162) has the molecular formula C49H54Cl2F2N2O6 and a molecular weight of 875.88 g/mol. Its IUPAC name is bis[4-(4-chlorophenyl)-1-[4-(4-fluorophenyl)-4-oxobutyl]piperidin-4-yl] heptanedioate.
| Compound Name | bis[4-(4-chlorophenyl)-1-[4-(4-fluorophenyl)-4-oxobutyl]piperidin-4-yl] heptanedioate |
|---|---|
| PubChem CID | 118709162 |
| Molecular Formula | C49H54Cl2F2N2O6 |
| Molecular Weight | 875.88 g/mol |
| Exact Mass | 874.33 |
| IUPAC Name | bis[4-(4-chlorophenyl)-1-[4-(4-fluorophenyl)-4-oxobutyl]piperidin-4-yl] heptanedioate |
| SMILES | O=C(CCCCCC(=O)OC1(c2ccc(Cl)cc2)CCN(CCCC(=O)c2ccc(F)cc2)CC1)OC1(c2ccc(Cl)cc2)CCN(CCCC(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C49H54Cl2F2N2O6/c50-40-18-14-38(15-19-40)48(26-32-54(33-27-48)30-4-6-44(56)36-10-22-42(52)23-11-36)60-46(58)8-2-1-3-9-47(59)61-49(39-16-20-41(51)21-17-39)28-34-55(35-29-49)31-5-7-45(57)37-12-24-43(53)25-13-37/h10-25H,1-9,26-35H2 |
| InChIKey | SXLLFTLZFDWMJK-UHFFFAOYSA-N |
| XLogP | 10.92 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 875.88 |
| LogP ≤ 5 | 10.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|