C31H41ClFNO3 — CID 71317191
[4-(4-chloro-2,3,5,6-tetradeuteriophenyl)-1-[4-(4-fluorophenyl)-4-oxobutyl]piperidin-4-yl] decanoate (PubChem CID 71317191) has the molecular formula C31H41ClFNO3 and a molecular weight of 534.15 g/mol. Its IUPAC name is [4-(4-chloro-2,3,5,6-tetradeuteriophenyl)-1-[4-(4-fluorophenyl)-4-oxobutyl]piperidin-4-yl] decanoate.
| Compound Name | [4-(4-chloro-2,3,5,6-tetradeuteriophenyl)-1-[4-(4-fluorophenyl)-4-oxobutyl]piperidin-4-yl] decanoate |
|---|---|
| PubChem CID | 71317191 |
| Molecular Formula | C31H41ClFNO3 |
| Molecular Weight | 534.15 g/mol |
| Exact Mass | 533.30 |
| IUPAC Name | [4-(4-chloro-2,3,5,6-tetradeuteriophenyl)-1-[4-(4-fluorophenyl)-4-oxobutyl]piperidin-4-yl] decanoate |
| SMILES | [2H]c1c([2H])c(C2(OC(=O)CCCCCCCCC)CCN(CCCC(=O)c3ccc(F)cc3)CC2)c([2H])c([2H])c1Cl |
| InChI | InChI=1S/C31H41ClFNO3/c1-2-3-4-5-6-7-8-11-30(36)37-31(26-14-16-27(32)17-15-26)20-23-34(24-21-31)22-9-10-29(35)25-12-18-28(33)19-13-25/h12-19H,2-11,20-24H2,1H3/i14D,15D,16D,17D |
| InChIKey | GUTXTARXLVFHDK-GIVHGBEGSA-N |
| XLogP | 8.12 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.15 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|