C17H24FNO — CID 61421543
4-(4-ethylpiperidin-1-yl)-1-(4-fluorophenyl)butan-1-one (PubChem CID 61421543) has the molecular formula C17H24FNO and a molecular weight of 277.38 g/mol. Its IUPAC name is 4-(4-ethylpiperidin-1-yl)-1-(4-fluorophenyl)butan-1-one.
| Compound Name | 4-(4-ethylpiperidin-1-yl)-1-(4-fluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 61421543 |
| Molecular Formula | C17H24FNO |
| Molecular Weight | 277.38 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 4-(4-ethylpiperidin-1-yl)-1-(4-fluorophenyl)butan-1-one |
| SMILES | CCC1CCN(CCCC(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C17H24FNO/c1-2-14-9-12-19(13-10-14)11-3-4-17(20)15-5-7-16(18)8-6-15/h5-8,14H,2-4,9-13H2,1H3 |
| InChIKey | LTQDDHBYHHINOK-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.38 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |