C25H29FN2O2 — CID 174456400
2-[[1-[4-(4-fluorophenyl)-4-oxobutyl]piperidin-4-yl]methyl]-1,3-dihydroisoindole-1-carbaldehyde (PubChem CID 174456400) has the molecular formula C25H29FN2O2 and a molecular weight of 408.52 g/mol. Its IUPAC name is 2-[[1-[4-(4-fluorophenyl)-4-oxobutyl]piperidin-4-yl]methyl]-1,3-dihydroisoindole-1-carbaldehyde.
| Compound Name | 2-[[1-[4-(4-fluorophenyl)-4-oxobutyl]piperidin-4-yl]methyl]-1,3-dihydroisoindole-1-carbaldehyde |
|---|---|
| PubChem CID | 174456400 |
| Molecular Formula | C25H29FN2O2 |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 2-[[1-[4-(4-fluorophenyl)-4-oxobutyl]piperidin-4-yl]methyl]-1,3-dihydroisoindole-1-carbaldehyde |
| SMILES | O=CC1c2ccccc2CN1CC1CCN(CCCC(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C25H29FN2O2/c26-22-9-7-20(8-10-22)25(30)6-3-13-27-14-11-19(12-15-27)16-28-17-21-4-1-2-5-23(21)24(28)18-29/h1-2,4-5,7-10,18-19,24H,3,6,11-17H2 |
| InChIKey | FRMNMFMPBQTWCS-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|