C23H24FN3O4 — CID 174456576
2-[[1-[2-(4-fluorophenyl)-2-oxoethyl]piperidin-4-yl]methyl]-4-nitro-1,3-dihydroisoindole-1-carbaldehyde (PubChem CID 174456576) has the molecular formula C23H24FN3O4 and a molecular weight of 425.46 g/mol. Its IUPAC name is 2-[[1-[2-(4-fluorophenyl)-2-oxoethyl]piperidin-4-yl]methyl]-4-nitro-1,3-dihydroisoindole-1-carbaldehyde.
| Compound Name | 2-[[1-[2-(4-fluorophenyl)-2-oxoethyl]piperidin-4-yl]methyl]-4-nitro-1,3-dihydroisoindole-1-carbaldehyde |
|---|---|
| PubChem CID | 174456576 |
| Molecular Formula | C23H24FN3O4 |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 2-[[1-[2-(4-fluorophenyl)-2-oxoethyl]piperidin-4-yl]methyl]-4-nitro-1,3-dihydroisoindole-1-carbaldehyde |
| SMILES | O=CC1c2cccc([N+](=O)[O-])c2CN1CC1CCN(CC(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C23H24FN3O4/c24-18-6-4-17(5-7-18)23(29)14-25-10-8-16(9-11-25)12-26-13-20-19(22(26)15-28)2-1-3-21(20)27(30)31/h1-7,15-16,22H,8-14H2 |
| InChIKey | NJJXLQDMLJOJOS-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|