C23H25FN2O2 — CID 174442393
2-[[1-[2-(4-fluorophenyl)-2-oxoethyl]piperidin-4-yl]methyl]-1,3-dihydroisoindole-1-carbaldehyde (PubChem CID 174442393) has the molecular formula C23H25FN2O2 and a molecular weight of 380.46 g/mol. Its IUPAC name is 2-[[1-[2-(4-fluorophenyl)-2-oxoethyl]piperidin-4-yl]methyl]-1,3-dihydroisoindole-1-carbaldehyde.
| Compound Name | 2-[[1-[2-(4-fluorophenyl)-2-oxoethyl]piperidin-4-yl]methyl]-1,3-dihydroisoindole-1-carbaldehyde |
|---|---|
| PubChem CID | 174442393 |
| Molecular Formula | C23H25FN2O2 |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | 2-[[1-[2-(4-fluorophenyl)-2-oxoethyl]piperidin-4-yl]methyl]-1,3-dihydroisoindole-1-carbaldehyde |
| SMILES | O=CC1c2ccccc2CN1CC1CCN(CC(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C23H25FN2O2/c24-20-7-5-18(6-8-20)23(28)15-25-11-9-17(10-12-25)13-26-14-19-3-1-2-4-21(19)22(26)16-27/h1-8,16-17,22H,9-15H2 |
| InChIKey | NEMHOHZOBYYOMO-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|