C29H36FN4O3+ — CID 142804537
[2-[4-[4-(4-fluorophenyl)-4-(4-methylphenyl)butyl]piperazin-1-yl]-5-(hydroxycarbamoyl)phenyl]-methoxyazanium (PubChem CID 142804537) has the molecular formula C29H36FN4O3+ and a molecular weight of 507.63 g/mol. Its IUPAC name is [2-[4-[4-(4-fluorophenyl)-4-(4-methylphenyl)butyl]piperazin-1-yl]-5-(hydroxycarbamoyl)phenyl]-methoxyazanium.
| Compound Name | [2-[4-[4-(4-fluorophenyl)-4-(4-methylphenyl)butyl]piperazin-1-yl]-5-(hydroxycarbamoyl)phenyl]-methoxyazanium |
|---|---|
| PubChem CID | 142804537 |
| Molecular Formula | C29H36FN4O3+ |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.28 |
| IUPAC Name | [2-[4-[4-(4-fluorophenyl)-4-(4-methylphenyl)butyl]piperazin-1-yl]-5-(hydroxycarbamoyl)phenyl]-methoxyazanium |
| SMILES | CO[NH2+]c1cc(C(=O)NO)ccc1N1CCN(CCCC(c2ccc(C)cc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C29H35FN4O3/c1-21-5-7-22(8-6-21)26(23-9-12-25(30)13-10-23)4-3-15-33-16-18-34(19-17-33)28-14-11-24(29(35)31-36)20-27(28)32-37-2/h5-14,20,26,32,36H,3-4,15-19H2,1-2H3,(H,31,35)/p+1 |
| InChIKey | KKRGWCZYRCPZCF-UHFFFAOYSA-O |
| XLogP | 3.74 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|