C28H32N4O — CID 24746277
N-(2-amino-5-phenylphenyl)-4-(1,8-diazaspiro[4.5]decan-8-ylmethyl)benzamide (PubChem CID 24746277) has the molecular formula C28H32N4O and a molecular weight of 440.59 g/mol. Its IUPAC name is N-(2-amino-5-phenylphenyl)-4-(1,8-diazaspiro[4.5]decan-8-ylmethyl)benzamide.
| Compound Name | N-(2-amino-5-phenylphenyl)-4-(1,8-diazaspiro[4.5]decan-8-ylmethyl)benzamide |
|---|---|
| PubChem CID | 24746277 |
| Molecular Formula | C28H32N4O |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | N-(2-amino-5-phenylphenyl)-4-(1,8-diazaspiro[4.5]decan-8-ylmethyl)benzamide |
| SMILES | Nc1ccc(-c2ccccc2)cc1NC(=O)c1ccc(CN2CCC3(CCCN3)CC2)cc1 |
| InChI | InChI=1S/C28H32N4O/c29-25-12-11-24(22-5-2-1-3-6-22)19-26(25)31-27(33)23-9-7-21(8-10-23)20-32-17-14-28(15-18-32)13-4-16-30-28/h1-3,5-12,19,30H,4,13-18,20,29H2,(H,31,33) |
| InChIKey | LZBKXQAVFZXXKI-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|