C32H38F2N2O10 — CID 6446930
2-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]ethyl acetate;bis((E)-but-2-enedioic acid) (PubChem CID 6446930) has the molecular formula C32H38F2N2O10 and a molecular weight of 648.66 g/mol. Its IUPAC name is 2-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]ethyl acetate;bis((E)-but-2-enedioic acid).
| Compound Name | 2-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]ethyl acetate;bis((E)-but-2-enedioic acid) |
|---|---|
| PubChem CID | 6446930 |
| Molecular Formula | C32H38F2N2O10 |
| Molecular Weight | 648.66 g/mol |
| Exact Mass | 648.25 |
| IUPAC Name | 2-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]ethyl acetate;bis((E)-but-2-enedioic acid) |
| SMILES | CC(=O)OCCN1CCN(CCCC(c2ccc(F)cc2)c2ccc(F)cc2)CC1.O=C(O)/C=C/C(=O)O.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C24H30F2N2O2.2C4H4O4/c1-19(29)30-18-17-28-15-13-27(14-16-28)12-2-3-24(20-4-8-22(25)9-5-20)21-6-10-23(26)11-7-21;2*5-3(6)1-2-4(7)8/h4-11,24H,2-3,12-18H2,1H3;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1+ |
| InChIKey | GYSMFCDQTRNICA-LVEZLNDCSA-N |
| XLogP | 3.48 |
| TPSA | 181.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.66 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|