C36H39F3N2O9 — CID 24858631
1-[2-[bis(4-fluorophenyl)methoxy]ethyl]-4-[(2R)-1-fluoro-3-phenylpropan-2-yl]piperazine;bis((Z)-but-2-enedioic acid) (PubChem CID 24858631) has the molecular formula C36H39F3N2O9 and a molecular weight of 700.71 g/mol. Its IUPAC name is 1-[2-[bis(4-fluorophenyl)methoxy]ethyl]-4-[(2R)-1-fluoro-3-phenylpropan-2-yl]piperazine;bis((Z)-but-2-enedioic acid).
| Compound Name | 1-[2-[bis(4-fluorophenyl)methoxy]ethyl]-4-[(2R)-1-fluoro-3-phenylpropan-2-yl]piperazine;bis((Z)-but-2-enedioic acid) |
|---|---|
| PubChem CID | 24858631 |
| Molecular Formula | C36H39F3N2O9 |
| Molecular Weight | 700.71 g/mol |
| Exact Mass | 700.26 |
| IUPAC Name | 1-[2-[bis(4-fluorophenyl)methoxy]ethyl]-4-[(2R)-1-fluoro-3-phenylpropan-2-yl]piperazine;bis((Z)-but-2-enedioic acid) |
| SMILES | FC[C@@H](Cc1ccccc1)N1CCN(CCOC(c2ccc(F)cc2)c2ccc(F)cc2)CC1.O=C(O)/C=C\C(=O)O.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C28H31F3N2O.2C4H4O4/c29-21-27(20-22-4-2-1-3-5-22)33-16-14-32(15-17-33)18-19-34-28(23-6-10-25(30)11-7-23)24-8-12-26(31)13-9-24;2*5-3(6)1-2-4(7)8/h1-13,27-28H,14-21H2;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1-/t27-;;/m1../s1 |
| InChIKey | DKKYTWCGTLKZOR-JMKARMGPSA-N |
| XLogP | 4.69 |
| TPSA | 164.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.71 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|