C32H34F2N2O5 — CID 70573063
1-[2-[bis(4-fluorophenyl)methoxy]ethyl]-4-(3-phenylprop-2-enyl)piperazine;(Z)-but-2-enedioic acid (PubChem CID 70573063) has the molecular formula C32H34F2N2O5 and a molecular weight of 564.63 g/mol. Its IUPAC name is 1-[2-[bis(4-fluorophenyl)methoxy]ethyl]-4-(3-phenylprop-2-enyl)piperazine;(Z)-but-2-enedioic acid.
| Compound Name | 1-[2-[bis(4-fluorophenyl)methoxy]ethyl]-4-(3-phenylprop-2-enyl)piperazine;(Z)-but-2-enedioic acid |
|---|---|
| PubChem CID | 70573063 |
| Molecular Formula | C32H34F2N2O5 |
| Molecular Weight | 564.63 g/mol |
| Exact Mass | 564.24 |
| IUPAC Name | 1-[2-[bis(4-fluorophenyl)methoxy]ethyl]-4-(3-phenylprop-2-enyl)piperazine;(Z)-but-2-enedioic acid |
| SMILES | Fc1ccc(C(OCCN2CCN(CC=Cc3ccccc3)CC2)c2ccc(F)cc2)cc1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C28H30F2N2O.C4H4O4/c29-26-12-8-24(9-13-26)28(25-10-14-27(30)15-11-25)33-22-21-32-19-17-31(18-20-32)16-4-7-23-5-2-1-3-6-23;5-3(6)1-2-4(7)8/h1-15,28H,16-22H2;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | XUVIYZVFSNUCSQ-BTJKTKAUSA-N |
| XLogP | 5.11 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.63 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|