C28H27ClF2N2O2 — CID 12634886
(E)-1-[4-[2-[bis(4-fluorophenyl)methoxy]ethyl]piperazin-1-yl]-3-(4-chlorophenyl)prop-2-en-1-one (PubChem CID 12634886) has the molecular formula C28H27ClF2N2O2 and a molecular weight of 496.99 g/mol. Its IUPAC name is (E)-1-[4-[2-[bis(4-fluorophenyl)methoxy]ethyl]piperazin-1-yl]-3-(4-chlorophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-[2-[bis(4-fluorophenyl)methoxy]ethyl]piperazin-1-yl]-3-(4-chlorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 12634886 |
| Molecular Formula | C28H27ClF2N2O2 |
| Molecular Weight | 496.99 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | (E)-1-[4-[2-[bis(4-fluorophenyl)methoxy]ethyl]piperazin-1-yl]-3-(4-chlorophenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1)N1CCN(CCOC(c2ccc(F)cc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C28H27ClF2N2O2/c29-24-8-1-21(2-9-24)3-14-27(34)33-17-15-32(16-18-33)19-20-35-28(22-4-10-25(30)11-5-22)23-6-12-26(31)13-7-23/h1-14,28H,15-20H2/b14-3+ |
| InChIKey | ZBPXHTCVLBTEET-LZWSPWQCSA-N |
| XLogP | 5.58 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.99 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|