C19H22ClF2NO — CID 3024524
1-[2-[bis(4-fluorophenyl)methoxy]ethyl]pyrrolidine;hydrochloride (PubChem CID 3024524) has the molecular formula C19H22ClF2NO and a molecular weight of 353.84 g/mol. Its IUPAC name is 1-[2-[bis(4-fluorophenyl)methoxy]ethyl]pyrrolidine;hydrochloride.
| Compound Name | 1-[2-[bis(4-fluorophenyl)methoxy]ethyl]pyrrolidine;hydrochloride |
|---|---|
| PubChem CID | 3024524 |
| Molecular Formula | C19H22ClF2NO |
| Molecular Weight | 353.84 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 1-[2-[bis(4-fluorophenyl)methoxy]ethyl]pyrrolidine;hydrochloride |
| SMILES | Cl.Fc1ccc(C(OCCN2CCCC2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C19H21F2NO.ClH/c20-17-7-3-15(4-8-17)19(16-5-9-18(21)10-6-16)23-14-13-22-11-1-2-12-22;/h3-10,19H,1-2,11-14H2;1H |
| InChIKey | JUOPZCKECYEAPF-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.84 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |