C23H29F2N3O2 — CID 86747464
N-[4-[4-[2-[bis(4-fluorophenyl)methoxy]ethyl]piperazin-1-yl]butan-2-ylidene]hydroxylamine (PubChem CID 86747464) has the molecular formula C23H29F2N3O2 and a molecular weight of 417.50 g/mol. Its IUPAC name is N-[4-[4-[2-[bis(4-fluorophenyl)methoxy]ethyl]piperazin-1-yl]butan-2-ylidene]hydroxylamine.
| Compound Name | N-[4-[4-[2-[bis(4-fluorophenyl)methoxy]ethyl]piperazin-1-yl]butan-2-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 86747464 |
| Molecular Formula | C23H29F2N3O2 |
| Molecular Weight | 417.50 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | N-[4-[4-[2-[bis(4-fluorophenyl)methoxy]ethyl]piperazin-1-yl]butan-2-ylidene]hydroxylamine |
| SMILES | CC(CCN1CCN(CCOC(c2ccc(F)cc2)c2ccc(F)cc2)CC1)=NO |
| InChI | InChI=1S/C23H29F2N3O2/c1-18(26-29)10-11-27-12-14-28(15-13-27)16-17-30-23(19-2-6-21(24)7-3-19)20-4-8-22(25)9-5-20/h2-9,23,29H,10-17H2,1H3 |
| InChIKey | JELVCGLWFRIIRX-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 48.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.50 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|