C20H24F2N2O — CID 4742801
1-[2-[bis(4-fluorophenyl)methoxy]ethyl]-4-methylpiperazine (PubChem CID 4742801) has the molecular formula C20H24F2N2O and a molecular weight of 346.42 g/mol. Its IUPAC name is 1-[2-[bis(4-fluorophenyl)methoxy]ethyl]-4-methylpiperazine.
| Compound Name | 1-[2-[bis(4-fluorophenyl)methoxy]ethyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 4742801 |
| Molecular Formula | C20H24F2N2O |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 1-[2-[bis(4-fluorophenyl)methoxy]ethyl]-4-methylpiperazine |
| SMILES | CN1CCN(CCOC(c2ccc(F)cc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H24F2N2O/c1-23-10-12-24(13-11-23)14-15-25-20(16-2-6-18(21)7-3-16)17-4-8-19(22)9-5-17/h2-9,20H,10-15H2,1H3 |
| InChIKey | VFMYPNYGLOWZLF-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |