C21H26ClF2N3OS — CID 23371521
4-[2-[bis(4-fluorophenyl)methoxy]ethyl]-N-methylpiperazine-1-carbothioamide;hydrochloride (PubChem CID 23371521) has the molecular formula C21H26ClF2N3OS and a molecular weight of 441.98 g/mol. Its IUPAC name is 4-[2-[bis(4-fluorophenyl)methoxy]ethyl]-N-methylpiperazine-1-carbothioamide;hydrochloride.
| Compound Name | 4-[2-[bis(4-fluorophenyl)methoxy]ethyl]-N-methylpiperazine-1-carbothioamide;hydrochloride |
|---|---|
| PubChem CID | 23371521 |
| Molecular Formula | C21H26ClF2N3OS |
| Molecular Weight | 441.98 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 4-[2-[bis(4-fluorophenyl)methoxy]ethyl]-N-methylpiperazine-1-carbothioamide;hydrochloride |
| SMILES | CNC(=S)N1CCN(CCOC(c2ccc(F)cc2)c2ccc(F)cc2)CC1.Cl |
| InChI | InChI=1S/C21H25F2N3OS.ClH/c1-24-21(28)26-12-10-25(11-13-26)14-15-27-20(16-2-6-18(22)7-3-16)17-4-8-19(23)9-5-17;/h2-9,20H,10-15H2,1H3,(H,24,28);1H |
| InChIKey | MYNZKHXCMKYEMX-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.98 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|