C26H33F2N3O2 — CID 23371543
4-[2-[bis(4-fluorophenyl)methoxy]ethyl]-N-cyclohexylpiperazine-1-carboxamide (PubChem CID 23371543) has the molecular formula C26H33F2N3O2 and a molecular weight of 457.57 g/mol. Its IUPAC name is 4-[2-[bis(4-fluorophenyl)methoxy]ethyl]-N-cyclohexylpiperazine-1-carboxamide.
| Compound Name | 4-[2-[bis(4-fluorophenyl)methoxy]ethyl]-N-cyclohexylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 23371543 |
| Molecular Formula | C26H33F2N3O2 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | 4-[2-[bis(4-fluorophenyl)methoxy]ethyl]-N-cyclohexylpiperazine-1-carboxamide |
| SMILES | O=C(NC1CCCCC1)N1CCN(CCOC(c2ccc(F)cc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C26H33F2N3O2/c27-22-10-6-20(7-11-22)25(21-8-12-23(28)13-9-21)33-19-18-30-14-16-31(17-15-30)26(32)29-24-4-2-1-3-5-24/h6-13,24-25H,1-5,14-19H2,(H,29,32) |
| InChIKey | MUOPJHXPYBMOTB-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |