C24H29F2N3O3 — CID 70260999
[4-[2-[bis(4-fluorophenyl)methoxy]ethyl]piperazin-1-yl]-morpholin-2-ylmethanone (PubChem CID 70260999) has the molecular formula C24H29F2N3O3 and a molecular weight of 445.51 g/mol. Its IUPAC name is [4-[2-[bis(4-fluorophenyl)methoxy]ethyl]piperazin-1-yl]-morpholin-2-ylmethanone.
| Compound Name | [4-[2-[bis(4-fluorophenyl)methoxy]ethyl]piperazin-1-yl]-morpholin-2-ylmethanone |
|---|---|
| PubChem CID | 70260999 |
| Molecular Formula | C24H29F2N3O3 |
| Molecular Weight | 445.51 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | [4-[2-[bis(4-fluorophenyl)methoxy]ethyl]piperazin-1-yl]-morpholin-2-ylmethanone |
| SMILES | O=C(C1CNCCO1)N1CCN(CCOC(c2ccc(F)cc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C24H29F2N3O3/c25-20-5-1-18(2-6-20)23(19-3-7-21(26)8-4-19)32-16-14-28-10-12-29(13-11-28)24(30)22-17-27-9-15-31-22/h1-8,22-23,27H,9-17H2 |
| InChIKey | FEVNWYMDPSGONG-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.51 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |