C12H25Cl2N3O3 — CID 119838568
[4-(2-methoxyethyl)piperazin-1-yl]-morpholin-2-ylmethanone;dihydrochloride (PubChem CID 119838568) has the molecular formula C12H25Cl2N3O3 and a molecular weight of 330.26 g/mol. Its IUPAC name is [4-(2-methoxyethyl)piperazin-1-yl]-morpholin-2-ylmethanone;dihydrochloride.
| Compound Name | [4-(2-methoxyethyl)piperazin-1-yl]-morpholin-2-ylmethanone;dihydrochloride |
|---|---|
| PubChem CID | 119838568 |
| Molecular Formula | C12H25Cl2N3O3 |
| Molecular Weight | 330.26 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | [4-(2-methoxyethyl)piperazin-1-yl]-morpholin-2-ylmethanone;dihydrochloride |
| SMILES | COCCN1CCN(C(=O)C2CNCCO2)CC1.Cl.Cl |
| InChI | InChI=1S/C12H23N3O3.2ClH/c1-17-9-7-14-3-5-15(6-4-14)12(16)11-10-13-2-8-18-11;;/h11,13H,2-10H2,1H3;2*1H |
| InChIKey | ZQPMLOJCKYVUOT-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.26 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |