C14H27Cl2N3O3 — CID 119897545
morpholin-2-yl-[4-(oxolan-3-ylmethyl)piperazin-1-yl]methanone;dihydrochloride (PubChem CID 119897545) has the molecular formula C14H27Cl2N3O3 and a molecular weight of 356.29 g/mol. Its IUPAC name is morpholin-2-yl-[4-(oxolan-3-ylmethyl)piperazin-1-yl]methanone;dihydrochloride.
| Compound Name | morpholin-2-yl-[4-(oxolan-3-ylmethyl)piperazin-1-yl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 119897545 |
| Molecular Formula | C14H27Cl2N3O3 |
| Molecular Weight | 356.29 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | morpholin-2-yl-[4-(oxolan-3-ylmethyl)piperazin-1-yl]methanone;dihydrochloride |
| SMILES | Cl.Cl.O=C(C1CNCCO1)N1CCN(CC2CCOC2)CC1 |
| InChI | InChI=1S/C14H25N3O3.2ClH/c18-14(13-9-15-2-8-20-13)17-5-3-16(4-6-17)10-12-1-7-19-11-12;;/h12-13,15H,1-11H2;2*1H |
| InChIKey | ISLJTCXBSLLAFX-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.29 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |