C16H23N3O3 — CID 99941257
[4-(4-methoxyphenyl)piperazin-1-yl]-[(2S)-morpholin-2-yl]methanone (PubChem CID 99941257) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is [4-(4-methoxyphenyl)piperazin-1-yl]-[(2S)-morpholin-2-yl]methanone.
| Compound Name | [4-(4-methoxyphenyl)piperazin-1-yl]-[(2S)-morpholin-2-yl]methanone |
|---|---|
| PubChem CID | 99941257 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | [4-(4-methoxyphenyl)piperazin-1-yl]-[(2S)-morpholin-2-yl]methanone |
| SMILES | COc1ccc(N2CCN(C(=O)[C@@H]3CNCCO3)CC2)cc1 |
| InChI | InChI=1S/C16H23N3O3/c1-21-14-4-2-13(3-5-14)18-7-9-19(10-8-18)16(20)15-12-17-6-11-22-15/h2-5,15,17H,6-12H2,1H3/t15-/m0/s1 |
| InChIKey | UUOXVVTVBRASAT-HNNXBMFYSA-N |
| XLogP | 0.33 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|